About 2-methanidylprop-1-ene;nickel
2-methanidylprop-1-ene;nickel (PubChem CID 173298029) has the molecular formula C4H7Ni2-
and a molecular weight of 172.49 g/mol. Its IUPAC name is 2-methanidylprop-1-ene;nickel.
Molecular Properties
| Compound Name | 2-methanidylprop-1-ene;nickel |
| PubChem CID | 173298029 |
| Molecular Formula | C4H7Ni2- |
| Molecular Weight | 172.49 g/mol |
| Exact Mass | 170.93 |
| IUPAC Name | 2-methanidylprop-1-ene;nickel |
| SMILES | C=C([CH2-])C.[Ni].[Ni] |
| InChI | InChI=1S/C4H7.2Ni/c1-4(2)3;;/h1-2H2,3H3;;/q-1;; |
| InChIKey | KYURRMHLGNXCGJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-methanidylprop-1-ene;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methanidylprop-1-ene;nickel?
The IUPAC name of 2-methanidylprop-1-ene;nickel (CID 173298029) is 2-methanidylprop-1-ene;nickel.
What is the SMILES notation for 2-methanidylprop-1-ene;nickel?
The canonical SMILES for 2-methanidylprop-1-ene;nickel is C=C([CH2-])C.[Ni].[Ni].
What is the InChIKey of 2-methanidylprop-1-ene;nickel?
The InChIKey is KYURRMHLGNXCGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7.2Ni/c1-4(2)3;;/h1-2H2,3H3;;/q-1;;.
What are the key properties of 2-methanidylprop-1-ene;nickel?
2-methanidylprop-1-ene;nickel has a molecular weight of 172.49 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methanidylprop-1-ene;nickel is sourced from PubChem (CID 173298029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).