About N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate
N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate (PubChem CID 173298940) has the molecular formula C12H23NO4Si
and a molecular weight of 273.40 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate.
Molecular Properties
| Compound Name | N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate |
| PubChem CID | 173298940 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate |
| SMILES | C=C(CCCOC)C(=O)O[SiH3].C=CC(=O)N(C)C |
| InChI | InChI=1S/C7H14O3Si.C5H9NO/c1-6(7(8)10-11)4-3-5-9-2;1-4-5(7)6(2)3/h1,3-5H2,2,11H3;4H,1H2,2-3H3 |
| InChIKey | BCXASAQKBDDOQU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate?
The IUPAC name of N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate (CID 173298940) is N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate.
What is the SMILES notation for N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate?
The canonical SMILES for N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate is C=C(CCCOC)C(=O)O[SiH3].C=CC(=O)N(C)C.
What is the InChIKey of N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate?
The InChIKey is BCXASAQKBDDOQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3Si.C5H9NO/c1-6(7(8)10-11)4-3-5-9-2;1-4-5(7)6(2)3/h1,3-5H2,2,11H3;4H,1H2,2-3H3.
What are the key properties of N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate?
N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate has a molecular weight of 273.40 g/mol, XLogP of 0.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylprop-2-enamide;silyl 5-methoxy-2-methylidenepentanoate is sourced from PubChem (CID 173298940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).