C23H29Cl2N3O2 — CID 173299083
5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl]penta-2,4-dienamide (PubChem CID 173299083) has the molecular formula C23H29Cl2N3O2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl]penta-2,4-dienamide.
| Compound Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 173299083 |
| Molecular Formula | C23H29Cl2N3O2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 5-(5,6-dichloro-1H-indol-2-yl)-2-methoxy-N-[(2,2,5,5-tetramethylpyrrolidin-3-yl)methyl]penta-2,4-dienamide |
| SMILES | COC(=CC=Cc1cc2cc(Cl)c(Cl)cc2[nH]1)C(=O)NCC1CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C23H29Cl2N3O2/c1-22(2)12-15(23(3,4)28-22)13-26-21(29)20(30-5)8-6-7-16-9-14-10-17(24)18(25)11-19(14)27-16/h6-11,15,27-28H,12-13H2,1-5H3,(H,26,29) |
| InChIKey | UHJHBVCRTWVSSF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|