About (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol
(5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol (PubChem CID 173299822) has the molecular formula C17H30O3Si
and a molecular weight of 310.51 g/mol. Its IUPAC name is (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol.
Molecular Properties
| Compound Name | (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol |
| PubChem CID | 173299822 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol |
| SMILES | CC(=CC[C@@H](O)CC#CCOC1CCCCO1)C(C)(C)[SiH3] |
| InChI | InChI=1S/C17H30O3Si/c1-14(17(2,3)21)10-11-15(18)8-4-6-12-19-16-9-5-7-13-20-16/h10,15-16,18H,5,7-9,11-13H2,1-3,21H3/t15-,16?/m0/s1 |
| InChIKey | UOKIYCWBNMOKOH-VYRBHSGPSA-N |
| XLogP | 2.18 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol?
The IUPAC name of (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol (CID 173299822) is (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol.
What is the SMILES notation for (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol?
The canonical SMILES for (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol is CC(=CC[C@@H](O)CC#CCOC1CCCCO1)C(C)(C)[SiH3].
What is the InChIKey of (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol?
The InChIKey is UOKIYCWBNMOKOH-VYRBHSGPSA-N. The full InChI is InChI=1S/C17H30O3Si/c1-14(17(2,3)21)10-11-15(18)8-4-6-12-19-16-9-5-7-13-20-16/h10,15-16,18H,5,7-9,11-13H2,1-3,21H3/t15-,16?/m0/s1.
What are the key properties of (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol?
(5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol has a molecular weight of 310.51 g/mol, XLogP of 2.18, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-8,9-dimethyl-1-(oxan-2-yloxy)-9-silyldec-7-en-2-yn-5-ol is sourced from PubChem (CID 173299822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).