About zinc;non-1-ene;propane
zinc;non-1-ene;propane (PubChem CID 173301341) has the molecular formula C12H24Zn
and a molecular weight of 233.71 g/mol. Its IUPAC name is zinc;non-1-ene;propane.
Molecular Properties
| Compound Name | zinc;non-1-ene;propane |
| PubChem CID | 173301341 |
| Molecular Formula | C12H24Zn |
| Molecular Weight | 233.71 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | zinc;non-1-ene;propane |
| SMILES | C=CCCCCCC[CH2-].C[CH-]C.[Zn+2] |
| InChI | InChI=1S/C9H17.C3H7.Zn/c1-3-5-7-9-8-6-4-2;1-3-2;/h3H,1-2,4-9H2;3H,1-2H3;/q2*-1;+2 |
| InChIKey | UICQPTCAAFUUAE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.71 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze zinc;non-1-ene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;non-1-ene;propane?
The IUPAC name of zinc;non-1-ene;propane (CID 173301341) is zinc;non-1-ene;propane.
What is the SMILES notation for zinc;non-1-ene;propane?
The canonical SMILES for zinc;non-1-ene;propane is C=CCCCCCC[CH2-].C[CH-]C.[Zn+2].
What is the InChIKey of zinc;non-1-ene;propane?
The InChIKey is UICQPTCAAFUUAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17.C3H7.Zn/c1-3-5-7-9-8-6-4-2;1-3-2;/h3H,1-2,4-9H2;3H,1-2H3;/q2*-1;+2.
What are the key properties of zinc;non-1-ene;propane?
zinc;non-1-ene;propane has a molecular weight of 233.71 g/mol, XLogP of 4.58, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;non-1-ene;propane is sourced from PubChem (CID 173301341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).