About CID 173302406
CID 173302406 (PubChem CID 173302406) has the molecular formula C34H25SnZr
and a molecular weight of 643.51 g/mol.
Molecular Properties
| Compound Name | CID 173302406 |
| PubChem CID | 173302406 |
| Molecular Formula | C34H25SnZr |
| Molecular Weight | 643.51 g/mol |
| Exact Mass | 643.00 |
| IUPAC Name | — |
| SMILES | C1=CC(c2cccc3c2C([Sn](c2ccccc2)c2ccccc2)c2ccccc2-3)c2ccccc21.[Zr] |
| InChI | InChI=1S/C22H15.2C6H5.Sn.Zr/c1-3-8-17-15(6-1)12-13-21(17)20-11-5-10-19-18-9-4-2-7-16(18)14-22(19)20;2*1-2-4-6-5-3-1;;/h1-14,21H;2*1-5H;; |
| InChIKey | INBVMCGTKJCJDD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 643.51 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 173302406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173302406?
The IUPAC name of CID 173302406 (CID 173302406) is not available.
What is the SMILES notation for CID 173302406?
The canonical SMILES for CID 173302406 is C1=CC(c2cccc3c2C([Sn](c2ccccc2)c2ccccc2)c2ccccc2-3)c2ccccc21.[Zr].
What is the InChIKey of CID 173302406?
The InChIKey is INBVMCGTKJCJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15.2C6H5.Sn.Zr/c1-3-8-17-15(6-1)12-13-21(17)20-11-5-10-19-18-9-4-2-7-16(18)14-22(19)20;2*1-2-4-6-5-3-1;;/h1-14,21H;2*1-5H;;.
What are the key properties of CID 173302406?
CID 173302406 has a molecular weight of 643.51 g/mol, XLogP of 6.80, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173302406 is sourced from PubChem (CID 173302406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).