C27H34O5Si — CID 173302415
[(3aR,4R,5R,6aS)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate (PubChem CID 173302415) has the molecular formula C27H34O5Si and a molecular weight of 466.65 g/mol. Its IUPAC name is [(3aR,4R,5R,6aS)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate.
| Compound Name | [(3aR,4R,5R,6aS)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 173302415 |
| Molecular Formula | C27H34O5Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [(3aR,4R,5R,6aS)-4-(1-dimethylsilyloxy-2,2-dimethylpropyl)-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| SMILES | C[SiH](C)OC([C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1OC(=O)c1ccc(-c2ccccc2)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H34O5Si/c1-27(2,3)25(32-33(4)5)24-20-15-23(28)30-21(20)16-22(24)31-26(29)19-13-11-18(12-14-19)17-9-7-6-8-10-17/h6-14,20-22,24-25,33H,15-16H2,1-5H3/t20-,21-,22+,24+,25?/m0/s1 |
| InChIKey | NXYMVHMZGIFYOS-WDYNJKNGSA-N |
| XLogP | 5.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|