About (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane
(1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane (PubChem CID 173303042) has the molecular formula C10H21IOSi
and a molecular weight of 312.27 g/mol. Its IUPAC name is (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane.
Molecular Properties
| Compound Name | (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane |
| PubChem CID | 173303042 |
| Molecular Formula | C10H21IOSi |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane |
| SMILES | C[SiH](C)OC(I)C=CCC(C)(C)C |
| InChI | InChI=1S/C10H21IOSi/c1-10(2,3)8-6-7-9(11)12-13(4)5/h6-7,9,13H,8H2,1-5H3 |
| InChIKey | WVWRNJSBBRNUIY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane?
The IUPAC name of (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane (CID 173303042) is (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane.
What is the SMILES notation for (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane?
The canonical SMILES for (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane is C[SiH](C)OC(I)C=CCC(C)(C)C.
What is the InChIKey of (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane?
The InChIKey is WVWRNJSBBRNUIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21IOSi/c1-10(2,3)8-6-7-9(11)12-13(4)5/h6-7,9,13H,8H2,1-5H3.
What are the key properties of (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane?
(1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane has a molecular weight of 312.27 g/mol, XLogP of 3.74, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1-iodo-5,5-dimethylhex-2-enoxy)-dimethylsilane is sourced from PubChem (CID 173303042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).