C9H17NS — CID 173303099
3-[(2R)-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]propane-1-thiol (PubChem CID 173303099) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 3-[(2R)-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]propane-1-thiol.
| Compound Name | 3-[(2R)-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]propane-1-thiol |
|---|---|
| PubChem CID | 173303099 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 3-[(2R)-4-methyl-1,2,3,6-tetrahydropyridin-2-yl]propane-1-thiol |
| SMILES | CC1=CCN[C@H](CCCS)C1 |
| InChI | InChI=1S/C9H17NS/c1-8-4-5-10-9(7-8)3-2-6-11/h4,9-11H,2-3,5-7H2,1H3/t9-/m1/s1 |
| InChIKey | MYQBCKWDONZTOF-SECBINFHSA-N |
| XLogP | 2.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|