C14H10O10S3 — CID 173303172
2-(furan-2-yl)naphthalene-1,3,7-trisulfonic acid (PubChem CID 173303172) has the molecular formula C14H10O10S3 and a molecular weight of 434.43 g/mol. Its IUPAC name is 2-(furan-2-yl)naphthalene-1,3,7-trisulfonic acid.
| Compound Name | 2-(furan-2-yl)naphthalene-1,3,7-trisulfonic acid |
|---|---|
| PubChem CID | 173303172 |
| Molecular Formula | C14H10O10S3 |
| Molecular Weight | 434.43 g/mol |
| Exact Mass | 433.94 |
| IUPAC Name | 2-(furan-2-yl)naphthalene-1,3,7-trisulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2cc(S(=O)(=O)O)c(-c3ccco3)c(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C14H10O10S3/c15-25(16,17)9-4-3-8-6-12(26(18,19)20)13(11-2-1-5-24-11)14(10(8)7-9)27(21,22)23/h1-7H,(H,15,16,17)(H,18,19,20)(H,21,22,23) |
| InChIKey | VDIHUBUVGPYQPV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 176.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.43 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|