C24H30O2 — CID 173303173
(8R,9S,10R,13S,14S)-13-methyl-3',11-dimethylidenespiro[2,6,7,8,9,10,12,14-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxane]-3-one (PubChem CID 173303173) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-13-methyl-3',11-dimethylidenespiro[2,6,7,8,9,10,12,14-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxane]-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-13-methyl-3',11-dimethylidenespiro[2,6,7,8,9,10,12,14-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxane]-3-one |
|---|---|
| PubChem CID | 173303173 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | (8R,9S,10R,13S,14S)-13-methyl-3',11-dimethylidenespiro[2,6,7,8,9,10,12,14-octahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxane]-3-one |
| SMILES | C=C1C[C@@]2(C)[C@@H](C=CC23OCCCC3=C)[C@@H]2CCC3=CC(=O)CC[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C24H30O2/c1-15-14-23(3)21(10-11-24(23)16(2)5-4-12-26-24)20-8-6-17-13-18(25)7-9-19(17)22(15)20/h10-11,13,19-22H,1-2,4-9,12,14H2,3H3/t19-,20-,21-,22+,23-,24?/m0/s1 |
| InChIKey | GVHQTEDJHOONPL-LUGVDESVSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|