About 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one
5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (PubChem CID 173303618) has the molecular formula C5H4N4OSSe
and a molecular weight of 247.14 g/mol. Its IUPAC name is 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 173303618 |
| Molecular Formula | C5H4N4OSSe |
| Molecular Weight | 247.14 g/mol |
| Exact Mass | 247.93 |
| IUPAC Name | 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| SMILES | Nc1nc2nc([SeH])sc2c(=O)[nH]1 |
| InChI | InChI=1S/C5H4N4OSSe/c6-4-7-2-1(3(10)9-4)11-5(12)8-2/h(H4,6,7,8,9,10,12) |
| InChIKey | QXTCGZKLVAONFC-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.14 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CID 173303618) is 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is Nc1nc2nc([SeH])sc2c(=O)[nH]1.
What is the InChIKey of 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
The InChIKey is QXTCGZKLVAONFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4OSSe/c6-4-7-2-1(3(10)9-4)11-5(12)8-2/h(H4,6,7,8,9,10,12).
What are the key properties of 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one?
5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one has a molecular weight of 247.14 g/mol, XLogP of -1.51, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-selanyl-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 173303618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).