C12H23BSi — CID 173305253
(2-diethylboranyl-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 173305253) has the molecular formula C12H23BSi and a molecular weight of 206.21 g/mol. Its IUPAC name is (2-diethylboranyl-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (2-diethylboranyl-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 173305253 |
| Molecular Formula | C12H23BSi |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | (2-diethylboranyl-3,4,5-trimethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCB(CC)C1=C(C)C(C)=C(C)C1[SiH3] |
| InChI | InChI=1S/C12H23BSi/c1-6-13(7-2)11-9(4)8(3)10(5)12(11)14/h12H,6-7H2,1-5,14H3 |
| InChIKey | JNAWMEMTVMLFHY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|