C17H31N7 — CID 173305313
2-N,4-N-bis(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4-diamine (PubChem CID 173305313) has the molecular formula C17H31N7 and a molecular weight of 333.48 g/mol. Its IUPAC name is 2-N,4-N-bis(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 173305313 |
| Molecular Formula | C17H31N7 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 2-N,4-N-bis(2-piperidin-1-ylethyl)-1,3,5-triazine-2,4-diamine |
| SMILES | c1nc(NCCN2CCCCC2)nc(NCCN2CCCCC2)n1 |
| InChI | InChI=1S/C17H31N7/c1-3-9-23(10-4-1)13-7-18-16-20-15-21-17(22-16)19-8-14-24-11-5-2-6-12-24/h15H,1-14H2,(H2,18,19,20,21,22) |
| InChIKey | MZDCKKHHUYWZOG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |