About bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene
bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene (PubChem CID 173305314) has the molecular formula C16H28
and a molecular weight of 220.40 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene |
| PubChem CID | 173305314 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene |
| SMILES | C1=C2CCC(C1)C2.C=CCC(C)CC(C)C |
| InChI | InChI=1S/C9H18.C7H10/c1-5-6-9(4)7-8(2)3;1-2-7-4-3-6(1)5-7/h5,8-9H,1,6-7H2,2-4H3;1,7H,2-5H2 |
| InChIKey | KKDAGUZJXGECSL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene (CID 173305314) is bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene is C1=C2CCC(C1)C2.C=CCC(C)CC(C)C.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene?
The InChIKey is KKDAGUZJXGECSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18.C7H10/c1-5-6-9(4)7-8(2)3;1-2-7-4-3-6(1)5-7/h5,8-9H,1,6-7H2,2-4H3;1,7H,2-5H2.
What are the key properties of bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene?
bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene has a molecular weight of 220.40 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;4,6-dimethylhept-1-ene is sourced from PubChem (CID 173305314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).