C22H22 — CID 173306034
1-ethyl-2,4-dimethyl-3,5-diphenylbenzene (PubChem CID 173306034) has the molecular formula C22H22 and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-3,5-diphenylbenzene.
| Compound Name | 1-ethyl-2,4-dimethyl-3,5-diphenylbenzene |
|---|---|
| PubChem CID | 173306034 |
| Molecular Formula | C22H22 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-3,5-diphenylbenzene |
| SMILES | CCc1cc(-c2ccccc2)c(C)c(-c2ccccc2)c1C |
| InChI | InChI=1S/C22H22/c1-4-18-15-21(19-11-7-5-8-12-19)17(3)22(16(18)2)20-13-9-6-10-14-20/h5-15H,4H2,1-3H3 |
| InChIKey | KHUZQNBDODPSRZ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |