About 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium
1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium (PubChem CID 173306060) has the molecular formula C22H22N+
and a molecular weight of 300.43 g/mol. Its IUPAC name is 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium.
Molecular Properties
| Compound Name | 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium |
| PubChem CID | 173306060 |
| Molecular Formula | C22H22N+ |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium |
| SMILES | CCc1[nH+]c(-c2ccccc2)c(-c2ccccc2)c2c1CCC2 |
| InChI | InChI=1S/C22H21N/c1-2-20-18-14-9-15-19(18)21(16-10-5-3-6-11-16)22(23-20)17-12-7-4-8-13-17/h3-8,10-13H,2,9,14-15H2,1H3/p+1 |
| InChIKey | VWPNSKNMYXZNAF-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 14.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium?
The IUPAC name of 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium (CID 173306060) is 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium.
What is the SMILES notation for 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium?
The canonical SMILES for 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium is CCc1[nH+]c(-c2ccccc2)c(-c2ccccc2)c2c1CCC2.
What is the InChIKey of 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium?
The InChIKey is VWPNSKNMYXZNAF-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H21N/c1-2-20-18-14-9-15-19(18)21(16-10-5-3-6-11-16)22(23-20)17-12-7-4-8-13-17/h3-8,10-13H,2,9,14-15H2,1H3/p+1.
What are the key properties of 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium?
1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium has a molecular weight of 300.43 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3,4-diphenyl-6,7-dihydro-5H-cyclopenta[c]pyridin-2-ium is sourced from PubChem (CID 173306060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).