C28H42FN5O4S — CID 173306640
(2S,3aR,7aR)-N-[4-[N-[2-(cyclohexylamino)propanoyl]carbamimidoyl]-2-fluorophenyl]-N-ethylsulfonyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide (PubChem CID 173306640) has the molecular formula C28H42FN5O4S and a molecular weight of 563.74 g/mol. Its IUPAC name is (2S,3aR,7aR)-N-[4-[N-[2-(cyclohexylamino)propanoyl]carbamimidoyl]-2-fluorophenyl]-N-ethylsulfonyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide.
| Compound Name | (2S,3aR,7aR)-N-[4-[N-[2-(cyclohexylamino)propanoyl]carbamimidoyl]-2-fluorophenyl]-N-ethylsulfonyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
|---|---|
| PubChem CID | 173306640 |
| Molecular Formula | C28H42FN5O4S |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | (2S,3aR,7aR)-N-[4-[N-[2-(cyclohexylamino)propanoyl]carbamimidoyl]-2-fluorophenyl]-N-ethylsulfonyl-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| SMILES | [H]/N=C(\NC(=O)C(C)NC1CCCCC1)c1ccc(N(C(=O)[C@@H]2C[C@H]3CCCC[C@H]3N2C)S(=O)(=O)CC)c(F)c1 |
| InChI | InChI=1S/C28H42FN5O4S/c1-4-39(37,38)34(28(36)25-17-19-10-8-9-13-23(19)33(25)3)24-15-14-20(16-22(24)29)26(30)32-27(35)18(2)31-21-11-6-5-7-12-21/h14-16,18-19,21,23,25,31H,4-13,17H2,1-3H3,(H2,30,32,35)/t18?,19-,23-,25+/m1/s1 |
| InChIKey | UCNZCPBJQBBBJE-IGZAFBDVSA-N |
| XLogP | 3.52 |
| TPSA | 122.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|