C28H41F2N5O4S — CID 173306641
(2R,3aR,7aR)-N-[4-[N-(2-aminopropanoyl)carbamimidoyl]-2,6-difluorophenyl]-2-cyclohexyl-1-ethylsulfonyl-N-methyl-3a,4,5,6,7,7a-hexahydro-3H-indole-2-carboxamide (PubChem CID 173306641) has the molecular formula C28H41F2N5O4S and a molecular weight of 581.73 g/mol. Its IUPAC name is (2R,3aR,7aR)-N-[4-[N-(2-aminopropanoyl)carbamimidoyl]-2,6-difluorophenyl]-2-cyclohexyl-1-ethylsulfonyl-N-methyl-3a,4,5,6,7,7a-hexahydro-3H-indole-2-carboxamide.
| Compound Name | (2R,3aR,7aR)-N-[4-[N-(2-aminopropanoyl)carbamimidoyl]-2,6-difluorophenyl]-2-cyclohexyl-1-ethylsulfonyl-N-methyl-3a,4,5,6,7,7a-hexahydro-3H-indole-2-carboxamide |
|---|---|
| PubChem CID | 173306641 |
| Molecular Formula | C28H41F2N5O4S |
| Molecular Weight | 581.73 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | (2R,3aR,7aR)-N-[4-[N-(2-aminopropanoyl)carbamimidoyl]-2,6-difluorophenyl]-2-cyclohexyl-1-ethylsulfonyl-N-methyl-3a,4,5,6,7,7a-hexahydro-3H-indole-2-carboxamide |
| SMILES | [H]/N=C(\NC(=O)C(C)N)c1cc(F)c(N(C)C(=O)[C@]2(C3CCCCC3)C[C@H]3CCCC[C@H]3N2S(=O)(=O)CC)c(F)c1 |
| InChI | InChI=1S/C28H41F2N5O4S/c1-4-40(38,39)35-23-13-9-8-10-18(23)16-28(35,20-11-6-5-7-12-20)27(37)34(3)24-21(29)14-19(15-22(24)30)25(32)33-26(36)17(2)31/h14-15,17-18,20,23H,4-13,16,31H2,1-3H3,(H2,32,33,36)/t17?,18-,23-,28-/m1/s1 |
| InChIKey | DOYKTBUDXREOEN-JOCNSEIPSA-N |
| XLogP | 3.65 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.73 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|