About diheptyl but-2-enedioate;ethene
diheptyl but-2-enedioate;ethene (PubChem CID 173308008) has the molecular formula C20H36O4
and a molecular weight of 340.50 g/mol. Its IUPAC name is diheptyl but-2-enedioate;ethene.
Molecular Properties
| Compound Name | diheptyl but-2-enedioate;ethene |
| PubChem CID | 173308008 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | diheptyl but-2-enedioate;ethene |
| SMILES | C=C.CCCCCCCOC(=O)C=CC(=O)OCCCCCCC |
| InChI | InChI=1S/C18H32O4.C2H4/c1-3-5-7-9-11-15-21-17(19)13-14-18(20)22-16-12-10-8-6-4-2;1-2/h13-14H,3-12,15-16H2,1-2H3;1-2H2 |
| InChIKey | CSDVHJIOEPSFEM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diheptyl but-2-enedioate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diheptyl but-2-enedioate;ethene?
The IUPAC name of diheptyl but-2-enedioate;ethene (CID 173308008) is diheptyl but-2-enedioate;ethene.
What is the SMILES notation for diheptyl but-2-enedioate;ethene?
The canonical SMILES for diheptyl but-2-enedioate;ethene is C=C.CCCCCCCOC(=O)C=CC(=O)OCCCCCCC.
What is the InChIKey of diheptyl but-2-enedioate;ethene?
The InChIKey is CSDVHJIOEPSFEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4.C2H4/c1-3-5-7-9-11-15-21-17(19)13-14-18(20)22-16-12-10-8-6-4-2;1-2/h13-14H,3-12,15-16H2,1-2H3;1-2H2.
What are the key properties of diheptyl but-2-enedioate;ethene?
diheptyl but-2-enedioate;ethene has a molecular weight of 340.50 g/mol, XLogP of 5.37, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diheptyl but-2-enedioate;ethene is sourced from PubChem (CID 173308008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).