About sodium;hydride;sulfo acetate
sodium;hydride;sulfo acetate (PubChem CID 173308098) has the molecular formula C2H5NaO5S
and a molecular weight of 164.11 g/mol. Its IUPAC name is sodium;hydride;sulfo acetate.
Molecular Properties
| Compound Name | sodium;hydride;sulfo acetate |
| PubChem CID | 173308098 |
| Molecular Formula | C2H5NaO5S |
| Molecular Weight | 164.11 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | sodium;hydride;sulfo acetate |
| SMILES | CC(=O)OS(=O)(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C2H4O5S.Na.H/c1-2(3)7-8(4,5)6;;/h1H3,(H,4,5,6);;/q;+1;-1 |
| InChIKey | SAHZAFNOGSMNLK-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.11 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;sulfo acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;sulfo acetate?
The IUPAC name of sodium;hydride;sulfo acetate (CID 173308098) is sodium;hydride;sulfo acetate.
What is the SMILES notation for sodium;hydride;sulfo acetate?
The canonical SMILES for sodium;hydride;sulfo acetate is CC(=O)OS(=O)(=O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;sulfo acetate?
The InChIKey is SAHZAFNOGSMNLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O5S.Na.H/c1-2(3)7-8(4,5)6;;/h1H3,(H,4,5,6);;/q;+1;-1.
What are the key properties of sodium;hydride;sulfo acetate?
sodium;hydride;sulfo acetate has a molecular weight of 164.11 g/mol, XLogP of -3.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;sulfo acetate is sourced from PubChem (CID 173308098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).