C22H28 — CID 173308168
1,4,5,8-tetrakis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 173308168) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1,4,5,8-tetrakis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1,4,5,8-tetrakis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 173308168 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,4,5,8-tetrakis(prop-2-enyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=CCc1ccc(CC=C)c2c1C(CC=C)CCC2CC=C |
| InChI | InChI=1S/C22H28/c1-5-9-17-13-14-19(11-7-3)22-20(12-8-4)16-15-18(10-6-2)21(17)22/h5-8,13-14,18,20H,1-4,9-12,15-16H2 |
| InChIKey | RRTPQSYEFUSTDB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|