About 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane
4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane (PubChem CID 173308195) has the molecular formula C15H26N2O
and a molecular weight of 254.37 g/mol. Its IUPAC name is 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane.
Molecular Properties
| Compound Name | 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane |
| PubChem CID | 173308195 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane |
| SMILES | C=CC(C(C=C)N1CCCC[14CH2]1)N1CCO[14CH2]C1 |
| InChI | InChI=1S/C15H26N2O/c1-3-14(16-8-6-5-7-9-16)15(4-2)17-10-12-18-13-11-17/h3-4,14-15H,1-2,5-13H2/i8+2,12+2 |
| InChIKey | LXFQUMUXSUVLGO-SYVOJYFPSA-N |
| XLogP | 1.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane?
The IUPAC name of 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane (CID 173308195) is 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane.
What is the SMILES notation for 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane?
The canonical SMILES for 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane is C=CC(C(C=C)N1CCCC[14CH2]1)N1CCO[14CH2]C1.
What is the InChIKey of 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane?
The InChIKey is LXFQUMUXSUVLGO-SYVOJYFPSA-N. The full InChI is InChI=1S/C15H26N2O/c1-3-14(16-8-6-5-7-9-16)15(4-2)17-10-12-18-13-11-17/h3-4,14-15H,1-2,5-13H2/i8+2,12+2.
What are the key properties of 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane?
4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane has a molecular weight of 254.37 g/mol, XLogP of 1.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-((214C)azinan-1-yl)hexa-1,5-dien-3-yl]-(614C)1,4-oxazinane is sourced from PubChem (CID 173308195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).