About N-chloro-2-methyl-N-silylpropan-2-amine;titanium
N-chloro-2-methyl-N-silylpropan-2-amine;titanium (PubChem CID 173308455) has the molecular formula C4H12ClNSiTi
and a molecular weight of 185.55 g/mol. Its IUPAC name is N-chloro-2-methyl-N-silylpropan-2-amine;titanium.
Molecular Properties
| Compound Name | N-chloro-2-methyl-N-silylpropan-2-amine;titanium |
| PubChem CID | 173308455 |
| Molecular Formula | C4H12ClNSiTi |
| Molecular Weight | 185.55 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | N-chloro-2-methyl-N-silylpropan-2-amine;titanium |
| SMILES | CC(C)(C)N([SiH3])Cl.[Ti] |
| InChI | InChI=1S/C4H12ClNSi.Ti/c1-4(2,3)6(5)7;/h1-3,7H3; |
| InChIKey | FBXUCYHUQPTHGK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.55 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-2-methyl-N-silylpropan-2-amine;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-2-methyl-N-silylpropan-2-amine;titanium?
The IUPAC name of N-chloro-2-methyl-N-silylpropan-2-amine;titanium (CID 173308455) is N-chloro-2-methyl-N-silylpropan-2-amine;titanium.
What is the SMILES notation for N-chloro-2-methyl-N-silylpropan-2-amine;titanium?
The canonical SMILES for N-chloro-2-methyl-N-silylpropan-2-amine;titanium is CC(C)(C)N([SiH3])Cl.[Ti].
What is the InChIKey of N-chloro-2-methyl-N-silylpropan-2-amine;titanium?
The InChIKey is FBXUCYHUQPTHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12ClNSi.Ti/c1-4(2,3)6(5)7;/h1-3,7H3;.
What are the key properties of N-chloro-2-methyl-N-silylpropan-2-amine;titanium?
N-chloro-2-methyl-N-silylpropan-2-amine;titanium has a molecular weight of 185.55 g/mol, XLogP of 0.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-2-methyl-N-silylpropan-2-amine;titanium is sourced from PubChem (CID 173308455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).