About 2,3-dicyanoprop-2-enamide
2,3-dicyanoprop-2-enamide (PubChem CID 173308718) has the molecular formula C5H3N3O
and a molecular weight of 121.10 g/mol. Its IUPAC name is 2,3-dicyanoprop-2-enamide.
Molecular Properties
| Compound Name | 2,3-dicyanoprop-2-enamide |
| PubChem CID | 173308718 |
| Molecular Formula | C5H3N3O |
| Molecular Weight | 121.10 g/mol |
| Exact Mass | 121.03 |
| IUPAC Name | 2,3-dicyanoprop-2-enamide |
| SMILES | N#CC=C(C#N)C(N)=O |
| InChI | InChI=1S/C5H3N3O/c6-2-1-4(3-7)5(8)9/h1H,(H2,8,9) |
| InChIKey | UITBKFJQPHYSPK-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.10 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dicyanoprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dicyanoprop-2-enamide?
The IUPAC name of 2,3-dicyanoprop-2-enamide (CID 173308718) is 2,3-dicyanoprop-2-enamide.
What is the SMILES notation for 2,3-dicyanoprop-2-enamide?
The canonical SMILES for 2,3-dicyanoprop-2-enamide is N#CC=C(C#N)C(N)=O.
What is the InChIKey of 2,3-dicyanoprop-2-enamide?
The InChIKey is UITBKFJQPHYSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N3O/c6-2-1-4(3-7)5(8)9/h1H,(H2,8,9).
What are the key properties of 2,3-dicyanoprop-2-enamide?
2,3-dicyanoprop-2-enamide has a molecular weight of 121.10 g/mol, XLogP of -0.55, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dicyanoprop-2-enamide is sourced from PubChem (CID 173308718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).