C19H19F3N4O — CID 173309221
2-amino-2-phenyl-2-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-5-(trifluoromethyl)phenyl]acetaldehyde (PubChem CID 173309221) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-amino-2-phenyl-2-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-5-(trifluoromethyl)phenyl]acetaldehyde.
| Compound Name | 2-amino-2-phenyl-2-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-5-(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 173309221 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-amino-2-phenyl-2-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)-5-(trifluoromethyl)phenyl]acetaldehyde |
| SMILES | NC(C=O)(c1ccccc1)c1cc(NC2=NCCCN2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H19F3N4O/c20-19(21,22)15-9-14(18(23,12-27)13-5-2-1-3-6-13)10-16(11-15)26-17-24-7-4-8-25-17/h1-3,5-6,9-12H,4,7-8,23H2,(H2,24,25,26) |
| InChIKey | FCWWOPLQWICBHB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|