C20H30N6O4S — CID 173309586
5-[4-(1H-imidazol-2-ylamino)butyl]-N-(2,4,6-trimethyl-3-sulfamoylphenyl)-1,2-oxazolidine-3-carboxamide (PubChem CID 173309586) has the molecular formula C20H30N6O4S and a molecular weight of 450.57 g/mol. Its IUPAC name is 5-[4-(1H-imidazol-2-ylamino)butyl]-N-(2,4,6-trimethyl-3-sulfamoylphenyl)-1,2-oxazolidine-3-carboxamide.
| Compound Name | 5-[4-(1H-imidazol-2-ylamino)butyl]-N-(2,4,6-trimethyl-3-sulfamoylphenyl)-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 173309586 |
| Molecular Formula | C20H30N6O4S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 5-[4-(1H-imidazol-2-ylamino)butyl]-N-(2,4,6-trimethyl-3-sulfamoylphenyl)-1,2-oxazolidine-3-carboxamide |
| SMILES | Cc1cc(C)c(S(N)(=O)=O)c(C)c1NC(=O)C1CC(CCCCNc2ncc[nH]2)ON1 |
| InChI | InChI=1S/C20H30N6O4S/c1-12-10-13(2)18(31(21,28)29)14(3)17(12)25-19(27)16-11-15(30-26-16)6-4-5-7-22-20-23-8-9-24-20/h8-10,15-16,26H,4-7,11H2,1-3H3,(H,25,27)(H2,21,28,29)(H2,22,23,24) |
| InChIKey | FPAQYFATBGIPMH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|