C39H59NO6Si — CID 173310059
(2R)-2-[(4S,5S)-4-(1-diphenylsilyloxy-2,2,5,5-tetramethylhexyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-2-methylhex-4-enoic acid (PubChem CID 173310059) has the molecular formula C39H59NO6Si and a molecular weight of 665.99 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-4-(1-diphenylsilyloxy-2,2,5,5-tetramethylhexyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-2-methylhex-4-enoic acid.
| Compound Name | (2R)-2-[(4S,5S)-4-(1-diphenylsilyloxy-2,2,5,5-tetramethylhexyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-2-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 173310059 |
| Molecular Formula | C39H59NO6Si |
| Molecular Weight | 665.99 g/mol |
| Exact Mass | 665.41 |
| IUPAC Name | (2R)-2-[(4S,5S)-4-(1-diphenylsilyloxy-2,2,5,5-tetramethylhexyl)-2,2-dimethyl-3-[(2-methylpropan-2-yl)oxycarbonyl]-1,3-oxazolidin-5-yl]-2-methylhex-4-enoic acid |
| SMILES | CC=CC[C@@](C)(C(=O)O)[C@@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)CCC(C)(C)C |
| InChI | InChI=1S/C39H59NO6Si/c1-13-14-25-39(12,33(41)42)32-30(40(38(10,11)44-32)34(43)45-36(5,6)7)31(37(8,9)27-26-35(2,3)4)46-47(28-21-17-15-18-22-28)29-23-19-16-20-24-29/h13-24,30-32,47H,25-27H2,1-12H3,(H,41,42)/t30-,31?,32-,39-/m1/s1 |
| InChIKey | KWZQCLSUBHOHNQ-SLVXVCLDSA-N |
| XLogP | 7.56 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.99 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|