About 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid
4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid (PubChem CID 173310116) has the molecular formula C18H19NO4S2
and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid.
Molecular Properties
| Compound Name | 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid |
| PubChem CID | 173310116 |
| Molecular Formula | C18H19NO4S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid |
| SMILES | CCCS(=O)(=O)O.OCCC#Cc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C15H11NOS.C3H8O3S/c17-10-4-3-7-14-16-15-12-6-2-1-5-11(12)8-9-13(15)18-14;1-2-3-7(4,5)6/h1-2,5-6,8-9,17H,4,10H2;2-3H2,1H3,(H,4,5,6) |
| InChIKey | MICUZPBZXLAMPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid?
The IUPAC name of 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid (CID 173310116) is 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid.
What is the SMILES notation for 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid?
The canonical SMILES for 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid is CCCS(=O)(=O)O.OCCC#Cc1nc2c(ccc3ccccc32)s1.
What is the InChIKey of 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid?
The InChIKey is MICUZPBZXLAMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NOS.C3H8O3S/c17-10-4-3-7-14-16-15-12-6-2-1-5-11(12)8-9-13(15)18-14;1-2-3-7(4,5)6/h1-2,5-6,8-9,17H,4,10H2;2-3H2,1H3,(H,4,5,6).
What are the key properties of 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid?
4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid has a molecular weight of 377.49 g/mol, XLogP of 3.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzo[e][1,3]benzothiazol-2-ylbut-3-yn-1-ol;propane-1-sulfonic acid is sourced from PubChem (CID 173310116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).