C20H25ClN2 — CID 17331028
N-[(9-ethylcarbazol-3-yl)methyl]cyclopentanamine;hydrochloride (PubChem CID 17331028) has the molecular formula C20H25ClN2 and a molecular weight of 328.89 g/mol. Its IUPAC name is N-[(9-ethylcarbazol-3-yl)methyl]cyclopentanamine;hydrochloride.
| Compound Name | N-[(9-ethylcarbazol-3-yl)methyl]cyclopentanamine;hydrochloride |
|---|---|
| PubChem CID | 17331028 |
| Molecular Formula | C20H25ClN2 |
| Molecular Weight | 328.89 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[(9-ethylcarbazol-3-yl)methyl]cyclopentanamine;hydrochloride |
| SMILES | CCn1c2ccccc2c2cc(CNC3CCCC3)ccc21.Cl |
| InChI | InChI=1S/C20H24N2.ClH/c1-2-22-19-10-6-5-9-17(19)18-13-15(11-12-20(18)22)14-21-16-7-3-4-8-16;/h5-6,9-13,16,21H,2-4,7-8,14H2,1H3;1H |
| InChIKey | HIEDKPBYMZNOKB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |