C12H27NO3Si — CID 173310343
methyl (2S,3R)-2-(aminomethyl)-3-dimethylsilyloxy-3,4,4-trimethylpentanoate (PubChem CID 173310343) has the molecular formula C12H27NO3Si and a molecular weight of 261.44 g/mol. Its IUPAC name is methyl (2S,3R)-2-(aminomethyl)-3-dimethylsilyloxy-3,4,4-trimethylpentanoate.
| Compound Name | methyl (2S,3R)-2-(aminomethyl)-3-dimethylsilyloxy-3,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 173310343 |
| Molecular Formula | C12H27NO3Si |
| Molecular Weight | 261.44 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | methyl (2S,3R)-2-(aminomethyl)-3-dimethylsilyloxy-3,4,4-trimethylpentanoate |
| SMILES | COC(=O)[C@@H](CN)[C@@](C)(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27NO3Si/c1-11(2,3)12(4,16-17(6)7)9(8-13)10(14)15-5/h9,17H,8,13H2,1-7H3/t9-,12-/m1/s1 |
| InChIKey | ULTGLZBHQRSQQN-BXKDBHETSA-N |
| XLogP | 1.54 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|