C6H6N4O5S — CID 173310345
2-hydroxyimino-2-[5-(methoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetic acid (PubChem CID 173310345) has the molecular formula C6H6N4O5S and a molecular weight of 246.20 g/mol. Its IUPAC name is 2-hydroxyimino-2-[5-(methoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetic acid.
| Compound Name | 2-hydroxyimino-2-[5-(methoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 173310345 |
| Molecular Formula | C6H6N4O5S |
| Molecular Weight | 246.20 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2-hydroxyimino-2-[5-(methoxycarbonylamino)-1,2,4-thiadiazol-3-yl]acetic acid |
| SMILES | COC(=O)Nc1nc(C(=NO)C(=O)O)ns1 |
| InChI | InChI=1S/C6H6N4O5S/c1-15-6(13)8-5-7-3(10-16-5)2(9-14)4(11)12/h14H,1H3,(H,11,12)(H,7,8,10,13) |
| InChIKey | JDXWXLOBANFAPC-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 134.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.20 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|