C10H15N3O8S3 — CID 173310746
2-(morpholin-4-ylsulfamoyl)-5-sulfamoylbenzenesulfonic acid (PubChem CID 173310746) has the molecular formula C10H15N3O8S3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 2-(morpholin-4-ylsulfamoyl)-5-sulfamoylbenzenesulfonic acid.
| Compound Name | 2-(morpholin-4-ylsulfamoyl)-5-sulfamoylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173310746 |
| Molecular Formula | C10H15N3O8S3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 2-(morpholin-4-ylsulfamoyl)-5-sulfamoylbenzenesulfonic acid |
| SMILES | NS(=O)(=O)c1ccc(S(=O)(=O)NN2CCOCC2)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C10H15N3O8S3/c11-22(14,15)8-1-2-9(10(7-8)24(18,19)20)23(16,17)12-13-3-5-21-6-4-13/h1-2,7,12H,3-6H2,(H2,11,14,15)(H,18,19,20) |
| InChIKey | UDCZZAOFFSVFLZ-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 173.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|