C12H6F3N — CID 173310828
8-(trifluoromethyl)-3-azatricyclo[4.2.2.22,5]dodeca-1(8),2,4,6,9,11-hexaene (PubChem CID 173310828) has the molecular formula C12H6F3N and a molecular weight of 221.18 g/mol. Its IUPAC name is 8-(trifluoromethyl)-3-azatricyclo[4.2.2.22,5]dodeca-1(8),2,4,6,9,11-hexaene.
| Compound Name | 8-(trifluoromethyl)-3-azatricyclo[4.2.2.22,5]dodeca-1(8),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 173310828 |
| Molecular Formula | C12H6F3N |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 8-(trifluoromethyl)-3-azatricyclo[4.2.2.22,5]dodeca-1(8),2,4,6,9,11-hexaene |
| SMILES | FC(F)(F)c1cc2ccc1-c1ccc-2cn1 |
| InChI | InChI=1S/C12H6F3N/c13-12(14,15)10-5-7-1-3-9(10)11-4-2-8(7)6-16-11/h1-6H/b8-7-,11-9- |
| InChIKey | YORFWKOHCKNTIC-JCBKOVKPSA-N |
| XLogP | 3.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |