C27H38N2O2 — CID 173311186
N'-(4-tert-butylphenyl)-N-(4-methylphenyl)decanediamide (PubChem CID 173311186) has the molecular formula C27H38N2O2 and a molecular weight of 422.61 g/mol. Its IUPAC name is N'-(4-tert-butylphenyl)-N-(4-methylphenyl)decanediamide.
| Compound Name | N'-(4-tert-butylphenyl)-N-(4-methylphenyl)decanediamide |
|---|---|
| PubChem CID | 173311186 |
| Molecular Formula | C27H38N2O2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | N'-(4-tert-butylphenyl)-N-(4-methylphenyl)decanediamide |
| SMILES | Cc1ccc(NC(=O)CCCCCCCCC(=O)Nc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H38N2O2/c1-21-13-17-23(18-14-21)28-25(30)11-9-7-5-6-8-10-12-26(31)29-24-19-15-22(16-20-24)27(2,3)4/h13-20H,5-12H2,1-4H3,(H,28,30)(H,29,31) |
| InChIKey | ZEWXGTPTVLFZDJ-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|