C12H21NSi — CID 173311259
N-[[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine (PubChem CID 173311259) has the molecular formula C12H21NSi and a molecular weight of 207.39 g/mol. Its IUPAC name is N-[[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine.
| Compound Name | N-[[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 173311259 |
| Molecular Formula | C12H21NSi |
| Molecular Weight | 207.39 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-[[(2Z,4Z)-cycloocta-2,4,7-trien-1-yl]-dimethylsilyl]-N-methylmethanamine |
| SMILES | CN(C)[Si](C)(C)C1C=CC/C=C\C=C/1 |
| InChI | InChI=1S/C12H21NSi/c1-13(2)14(3,4)12-10-8-6-5-7-9-11-12/h5-6,8-12H,7H2,1-4H3/b6-5-,10-8-,11-9? |
| InChIKey | FOFYMPWEOGVTPX-ONFZRIIRSA-N |
| XLogP | 3.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|