C28H32O3 — CID 173311484
7-[2-(2-adamantyl)-2H-chromen-3-yl]-3-methylocta-2,4,6-trienoic acid (PubChem CID 173311484) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is 7-[2-(2-adamantyl)-2H-chromen-3-yl]-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-[2-(2-adamantyl)-2H-chromen-3-yl]-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 173311484 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | 7-[2-(2-adamantyl)-2H-chromen-3-yl]-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(C=CC=C(C)C1=Cc2ccccc2OC1C1C2CC3CC(C2)CC1C3)=CC(=O)O |
| InChI | InChI=1S/C28H32O3/c1-17(10-26(29)30)6-5-7-18(2)24-16-21-8-3-4-9-25(21)31-28(24)27-22-12-19-11-20(14-22)15-23(27)13-19/h3-10,16,19-20,22-23,27-28H,11-15H2,1-2H3,(H,29,30) |
| InChIKey | HZOROQNXLFBHPZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|