About 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid
2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid (PubChem CID 173311958) has the molecular formula C28H51O2P
and a molecular weight of 450.69 g/mol. Its IUPAC name is 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid.
Molecular Properties
| Compound Name | 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid |
| PubChem CID | 173311958 |
| Molecular Formula | C28H51O2P |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.Cc1ccccc1C(C)(C)P |
| InChI | InChI=1S/C18H36O2.C10H15P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-8-6-4-5-7-9(8)10(2,3)11/h2-17H2,1H3,(H,19,20);4-7H,11H2,1-3H3 |
| InChIKey | WAFJSMWHWZBTMM-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid?
The IUPAC name of 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid (CID 173311958) is 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid.
What is the SMILES notation for 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid?
The canonical SMILES for 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.Cc1ccccc1C(C)(C)P.
What is the InChIKey of 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid?
The InChIKey is WAFJSMWHWZBTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C10H15P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-8-6-4-5-7-9(8)10(2,3)11/h2-17H2,1H3,(H,19,20);4-7H,11H2,1-3H3.
What are the key properties of 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid?
2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid has a molecular weight of 450.69 g/mol, XLogP of 9.44, 17 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylphenyl)propan-2-ylphosphane;octadecanoic acid is sourced from PubChem (CID 173311958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).