About dinitro(silyloxy)silane
dinitro(silyloxy)silane (PubChem CID 173313410) has the molecular formula H4N2O5Si2
and a molecular weight of 168.21 g/mol. Its IUPAC name is dinitro(silyloxy)silane.
Molecular Properties
| Compound Name | dinitro(silyloxy)silane |
| PubChem CID | 173313410 |
| Molecular Formula | H4N2O5Si2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 167.97 |
| IUPAC Name | dinitro(silyloxy)silane |
| SMILES | O=[N+]([O-])[SiH](O[SiH3])[N+](=O)[O-] |
| InChI | InChI=1S/H4N2O5Si2/c3-1(4)9(7-8)2(5)6/h9H,8H3 |
| InChIKey | RGWHSFVBOLJBAO-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dinitro(silyloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dinitro(silyloxy)silane?
The IUPAC name of dinitro(silyloxy)silane (CID 173313410) is dinitro(silyloxy)silane.
What is the SMILES notation for dinitro(silyloxy)silane?
The canonical SMILES for dinitro(silyloxy)silane is O=[N+]([O-])[SiH](O[SiH3])[N+](=O)[O-].
What is the InChIKey of dinitro(silyloxy)silane?
The InChIKey is RGWHSFVBOLJBAO-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N2O5Si2/c3-1(4)9(7-8)2(5)6/h9H,8H3.
What are the key properties of dinitro(silyloxy)silane?
dinitro(silyloxy)silane has a molecular weight of 168.21 g/mol, XLogP of -2.45, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dinitro(silyloxy)silane is sourced from PubChem (CID 173313410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).