C17H18F3NO4 — CID 173313423
2-(N-cyclopropyl-5-ethyl-2,3,4-trifluoroanilino)-3-ethylbut-2-enedioic acid (PubChem CID 173313423) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-(N-cyclopropyl-5-ethyl-2,3,4-trifluoroanilino)-3-ethylbut-2-enedioic acid.
| Compound Name | 2-(N-cyclopropyl-5-ethyl-2,3,4-trifluoroanilino)-3-ethylbut-2-enedioic acid |
|---|---|
| PubChem CID | 173313423 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(N-cyclopropyl-5-ethyl-2,3,4-trifluoroanilino)-3-ethylbut-2-enedioic acid |
| SMILES | CCC(C(=O)O)=C(C(=O)O)N(c1cc(CC)c(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C17H18F3NO4/c1-3-8-7-11(13(19)14(20)12(8)18)21(9-5-6-9)15(17(24)25)10(4-2)16(22)23/h7,9H,3-6H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | ZAPYRMJVNPDNTD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|