About 21,22-dihydro-1H-porphyrin-2-one;platinum
21,22-dihydro-1H-porphyrin-2-one;platinum (PubChem CID 173314359) has the molecular formula C20H14N4OPt
and a molecular weight of 521.44 g/mol. Its IUPAC name is 21,22-dihydro-1H-porphyrin-2-one;platinum.
Molecular Properties
| Compound Name | 21,22-dihydro-1H-porphyrin-2-one;platinum |
| PubChem CID | 173314359 |
| Molecular Formula | C20H14N4OPt |
| Molecular Weight | 521.44 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | 21,22-dihydro-1H-porphyrin-2-one;platinum |
| SMILES | O=C1C=C2C=c3ccc([nH]3)=CC3=NC(=CC4=NC(=CC1N2)C=C4)C=C3.[Pt] |
| InChI | InChI=1S/C20H14N4O.Pt/c25-20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18;/h1-11,19,22,24H; |
| InChIKey | AOVHHZSOQGGFGM-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 521.44 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 21,22-dihydro-1H-porphyrin-2-one;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22-dihydro-1H-porphyrin-2-one;platinum?
The IUPAC name of 21,22-dihydro-1H-porphyrin-2-one;platinum (CID 173314359) is 21,22-dihydro-1H-porphyrin-2-one;platinum.
What is the SMILES notation for 21,22-dihydro-1H-porphyrin-2-one;platinum?
The canonical SMILES for 21,22-dihydro-1H-porphyrin-2-one;platinum is O=C1C=C2C=c3ccc([nH]3)=CC3=NC(=CC4=NC(=CC1N2)C=C4)C=C3.[Pt].
What is the InChIKey of 21,22-dihydro-1H-porphyrin-2-one;platinum?
The InChIKey is AOVHHZSOQGGFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N4O.Pt/c25-20-11-18-9-16-4-3-14(22-16)7-12-1-2-13(21-12)8-15-5-6-17(23-15)10-19(20)24-18;/h1-11,19,22,24H;.
What are the key properties of 21,22-dihydro-1H-porphyrin-2-one;platinum?
21,22-dihydro-1H-porphyrin-2-one;platinum has a molecular weight of 521.44 g/mol, XLogP of 0.80, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22-dihydro-1H-porphyrin-2-one;platinum is sourced from PubChem (CID 173314359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).