About sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate
sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate (PubChem CID 173314376) has the molecular formula C16H32NNaO2
and a molecular weight of 293.43 g/mol. Its IUPAC name is sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate |
| PubChem CID | 173314376 |
| Molecular Formula | C16H32NNaO2 |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.23 |
| IUPAC Name | sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate |
| SMILES | C=CCCCCCCCCCOC(=O)[C@@H](N)C(C)C.[H-].[Na+] |
| InChI | InChI=1S/C16H31NO2.Na.H/c1-4-5-6-7-8-9-10-11-12-13-19-16(18)15(17)14(2)3;;/h4,14-15H,1,5-13,17H2,2-3H3;;/q;+1;-1/t15-;;/m0../s1 |
| InChIKey | NJILNOGXSDPLIN-CKUXDGONSA-N |
| XLogP | 0.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate?
The IUPAC name of sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate (CID 173314376) is sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate.
What is the SMILES notation for sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate?
The canonical SMILES for sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate is C=CCCCCCCCCCOC(=O)[C@@H](N)C(C)C.[H-].[Na+].
What is the InChIKey of sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate?
The InChIKey is NJILNOGXSDPLIN-CKUXDGONSA-N. The full InChI is InChI=1S/C16H31NO2.Na.H/c1-4-5-6-7-8-9-10-11-12-13-19-16(18)15(17)14(2)3;;/h4,14-15H,1,5-13,17H2,2-3H3;;/q;+1;-1/t15-;;/m0../s1.
What are the key properties of sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate?
sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate has a molecular weight of 293.43 g/mol, XLogP of 0.94, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;undec-10-enyl (2S)-2-amino-3-methylbutanoate is sourced from PubChem (CID 173314376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).