C14H26F3NO4Si — CID 173314454
N-[(2R,4S,5S,6S)-2-tert-butyl-2-dimethylsilyloxy-5-hydroxy-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide (PubChem CID 173314454) has the molecular formula C14H26F3NO4Si and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[(2R,4S,5S,6S)-2-tert-butyl-2-dimethylsilyloxy-5-hydroxy-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R,4S,5S,6S)-2-tert-butyl-2-dimethylsilyloxy-5-hydroxy-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 173314454 |
| Molecular Formula | C14H26F3NO4Si |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | N-[(2R,4S,5S,6S)-2-tert-butyl-2-dimethylsilyloxy-5-hydroxy-6-methyloxan-4-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H]1O[C@](O[SiH](C)C)(C(C)(C)C)C[C@H](NC(=O)C(F)(F)F)[C@@H]1O |
| InChI | InChI=1S/C14H26F3NO4Si/c1-8-10(19)9(18-11(20)14(15,16)17)7-13(21-8,12(2,3)4)22-23(5)6/h8-10,19,23H,7H2,1-6H3,(H,18,20)/t8-,9-,10+,13+/m0/s1 |
| InChIKey | ARMUKOQUKKHCHX-QISWUMQESA-N |
| XLogP | 1.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|