C14H8F14O — CID 173314457
4,5,6,6,7,7,7-heptafluoro-3-(4,5,6,6,7,7,7-heptafluorohepta-1,4-dien-3-yloxy)hepta-1,4-diene (PubChem CID 173314457) has the molecular formula C14H8F14O and a molecular weight of 458.19 g/mol. Its IUPAC name is 4,5,6,6,7,7,7-heptafluoro-3-(4,5,6,6,7,7,7-heptafluorohepta-1,4-dien-3-yloxy)hepta-1,4-diene.
| Compound Name | 4,5,6,6,7,7,7-heptafluoro-3-(4,5,6,6,7,7,7-heptafluorohepta-1,4-dien-3-yloxy)hepta-1,4-diene |
|---|---|
| PubChem CID | 173314457 |
| Molecular Formula | C14H8F14O |
| Molecular Weight | 458.19 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 4,5,6,6,7,7,7-heptafluoro-3-(4,5,6,6,7,7,7-heptafluorohepta-1,4-dien-3-yloxy)hepta-1,4-diene |
| SMILES | C=CC(OC(C=C)C(F)=C(F)C(F)(F)C(F)(F)F)C(F)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F14O/c1-3-5(7(15)9(17)11(19,20)13(23,24)25)29-6(4-2)8(16)10(18)12(21,22)14(26,27)28/h3-6H,1-2H2 |
| InChIKey | PZDRNDSEBJDLGK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.19 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|