C17H28O2Si — CID 173314680
2-[pentyl(prop-2-enyl)silyl]-3-prop-2-enylhexa-2,5-dienoic acid (PubChem CID 173314680) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is 2-[pentyl(prop-2-enyl)silyl]-3-prop-2-enylhexa-2,5-dienoic acid.
| Compound Name | 2-[pentyl(prop-2-enyl)silyl]-3-prop-2-enylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 173314680 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-[pentyl(prop-2-enyl)silyl]-3-prop-2-enylhexa-2,5-dienoic acid |
| SMILES | C=CCC(CC=C)=C(C(=O)O)[SiH](CC=C)CCCCC |
| InChI | InChI=1S/C17H28O2Si/c1-5-9-10-14-20(13-8-4)16(17(18)19)15(11-6-2)12-7-3/h6-8,20H,2-5,9-14H2,1H3,(H,18,19) |
| InChIKey | XAKVKZYUXVREHF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|