C25H38N6O7 — CID 173314778
[2-benzamido-5-(butylcarbamoylamino)-4-(N'-hydroxycarbamimidoyl)-1-pentanoylpiperidin-4-yl] ethaneperoxoate (PubChem CID 173314778) has the molecular formula C25H38N6O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is [2-benzamido-5-(butylcarbamoylamino)-4-(N'-hydroxycarbamimidoyl)-1-pentanoylpiperidin-4-yl] ethaneperoxoate.
| Compound Name | [2-benzamido-5-(butylcarbamoylamino)-4-(N'-hydroxycarbamimidoyl)-1-pentanoylpiperidin-4-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 173314778 |
| Molecular Formula | C25H38N6O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [2-benzamido-5-(butylcarbamoylamino)-4-(N'-hydroxycarbamimidoyl)-1-pentanoylpiperidin-4-yl] ethaneperoxoate |
| SMILES | CCCCNC(=O)NC1CN(C(=O)CCCC)C(NC(=O)c2ccccc2)CC1(OOC(C)=O)C(N)=NO |
| InChI | InChI=1S/C25H38N6O7/c1-4-6-13-21(33)31-16-19(28-24(35)27-14-7-5-2)25(23(26)30-36,38-37-17(3)32)15-20(31)29-22(34)18-11-9-8-10-12-18/h8-12,19-20,36H,4-7,13-16H2,1-3H3,(H2,26,30)(H,29,34)(H2,27,28,35) |
| InChIKey | QXWRWHYGDPRHMX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 184.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|