About [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate
[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate (PubChem CID 173315069) has the molecular formula C19H26N4O6
and a molecular weight of 406.44 g/mol. Its IUPAC name is [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate.
Molecular Properties
| Compound Name | [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate |
| PubChem CID | 173315069 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate |
| SMILES | CCCC(=O)N1CCC(OOC(C)=O)(C(N)=NO)CC1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26N4O6/c1-3-7-16(25)23-11-10-19(18(20)22-27,29-28-13(2)24)12-15(23)21-17(26)14-8-5-4-6-9-14/h4-6,8-9,15,27H,3,7,10-12H2,1-2H3,(H2,20,22)(H,21,26) |
| InChIKey | FDROAWLHWNSRSE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate?
The IUPAC name of [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate (CID 173315069) is [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate.
What is the SMILES notation for [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate?
The canonical SMILES for [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate is CCCC(=O)N1CCC(OOC(C)=O)(C(N)=NO)CC1NC(=O)c1ccccc1.
What is the InChIKey of [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate?
The InChIKey is FDROAWLHWNSRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N4O6/c1-3-7-16(25)23-11-10-19(18(20)22-27,29-28-13(2)24)12-15(23)21-17(26)14-8-5-4-6-9-14/h4-6,8-9,15,27H,3,7,10-12H2,1-2H3,(H2,20,22)(H,21,26).
What are the key properties of [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate?
[2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate has a molecular weight of 406.44 g/mol, XLogP of 1.14, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-benzamido-1-butanoyl-4-(N'-hydroxycarbamimidoyl)piperidin-4-yl] ethaneperoxoate is sourced from PubChem (CID 173315069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).