C30H33F3O9S2 — CID 173315276
tert-butyl [3-[2-[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-3-sulfanylphenyl]phenyl] carbonate;2,2,2-trifluoroethanesulfonic acid (PubChem CID 173315276) has the molecular formula C30H33F3O9S2 and a molecular weight of 658.71 g/mol. Its IUPAC name is tert-butyl [3-[2-[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-3-sulfanylphenyl]phenyl] carbonate;2,2,2-trifluoroethanesulfonic acid.
| Compound Name | tert-butyl [3-[2-[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-3-sulfanylphenyl]phenyl] carbonate;2,2,2-trifluoroethanesulfonic acid |
|---|---|
| PubChem CID | 173315276 |
| Molecular Formula | C30H33F3O9S2 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.15 |
| IUPAC Name | tert-butyl [3-[2-[3-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]-3-sulfanylphenyl]phenyl] carbonate;2,2,2-trifluoroethanesulfonic acid |
| SMILES | CC(C)(C)OC(=O)Oc1cccc(-c2cccc(S)c2-c2cccc(OC(=O)OC(C)(C)C)c2)c1.O=S(=O)(O)CC(F)(F)F |
| InChI | InChI=1S/C28H30O6S.C2H3F3O3S/c1-27(2,3)33-25(29)31-20-12-7-10-18(16-20)22-14-9-15-23(35)24(22)19-11-8-13-21(17-19)32-26(30)34-28(4,5)6;3-2(4,5)1-9(6,7)8/h7-17,35H,1-6H3;1H2,(H,6,7,8) |
| InChIKey | KRJAAQYSSBIGSM-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|