About N,N-diphenyl-2-silyloxan-2-amine;iron
N,N-diphenyl-2-silyloxan-2-amine;iron (PubChem CID 173315730) has the molecular formula C17H21FeNOSi
and a molecular weight of 339.29 g/mol. Its IUPAC name is N,N-diphenyl-2-silyloxan-2-amine;iron.
Molecular Properties
| Compound Name | N,N-diphenyl-2-silyloxan-2-amine;iron |
| PubChem CID | 173315730 |
| Molecular Formula | C17H21FeNOSi |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N,N-diphenyl-2-silyloxan-2-amine;iron |
| SMILES | [Fe].[SiH3]C1(N(c2ccccc2)c2ccccc2)CCCCO1 |
| InChI | InChI=1S/C17H21NOSi.Fe/c20-17(13-7-8-14-19-17)18(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2,20H3; |
| InChIKey | LNXMJZAHEHWAOR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-diphenyl-2-silyloxan-2-amine;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diphenyl-2-silyloxan-2-amine;iron?
The IUPAC name of N,N-diphenyl-2-silyloxan-2-amine;iron (CID 173315730) is N,N-diphenyl-2-silyloxan-2-amine;iron.
What is the SMILES notation for N,N-diphenyl-2-silyloxan-2-amine;iron?
The canonical SMILES for N,N-diphenyl-2-silyloxan-2-amine;iron is [Fe].[SiH3]C1(N(c2ccccc2)c2ccccc2)CCCCO1.
What is the InChIKey of N,N-diphenyl-2-silyloxan-2-amine;iron?
The InChIKey is LNXMJZAHEHWAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NOSi.Fe/c20-17(13-7-8-14-19-17)18(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1-6,9-12H,7-8,13-14H2,20H3;.
What are the key properties of N,N-diphenyl-2-silyloxan-2-amine;iron?
N,N-diphenyl-2-silyloxan-2-amine;iron has a molecular weight of 339.29 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diphenyl-2-silyloxan-2-amine;iron is sourced from PubChem (CID 173315730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).