About 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium
2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium (PubChem CID 173315901) has the molecular formula C3H6N2O2
and a molecular weight of 103.10 g/mol. Its IUPAC name is 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium.
Molecular Properties
| Compound Name | 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium |
| PubChem CID | 173315901 |
| Molecular Formula | C3H6N2O2 |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium |
| SMILES | [2H]C1=[N+]([O-])CCN1O |
| InChI | InChI=1S/C3H6N2O2/c6-4-1-2-5(7)3-4/h3,6H,1-2H2/i3D |
| InChIKey | RLCFSGGECJSWAQ-WFVSFCRTSA-N |
| XLogP | -0.77 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium?
The IUPAC name of 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium (CID 173315901) is 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium.
What is the SMILES notation for 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium?
The canonical SMILES for 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium is [2H]C1=[N+]([O-])CCN1O.
What is the InChIKey of 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium?
The InChIKey is RLCFSGGECJSWAQ-WFVSFCRTSA-N. The full InChI is InChI=1S/C3H6N2O2/c6-4-1-2-5(7)3-4/h3,6H,1-2H2/i3D.
What are the key properties of 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium?
2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium has a molecular weight of 103.10 g/mol, XLogP of -0.77, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-deuterio-1-hydroxy-3-oxido-4,5-dihydroimidazol-3-ium is sourced from PubChem (CID 173315901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).